Linzagolix structure
|
Common Name | Linzagolix | ||
|---|---|---|---|---|
| CAS Number | 935283-04-8 | Molecular Weight | 508.424 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H15F3N2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LinzagolixA novel potent gonadotrophin releasing hormone (GnRH) antagonist. |
| Name | Linzagolix |
|---|---|
| Synonym | More Synonyms |
| Description | A novel potent gonadotrophin releasing hormone (GnRH) antagonist. |
|---|---|
| References | References View Related Products by Target GNRH Receptor |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C22H15F3N2O7S |
| Molecular Weight | 508.424 |
| Exact Mass | 508.055206 |
| LogP | 3.07 |
| Index of Refraction | 1.621 |
| InChIKey | BMAAMIIYNNPHAB-UHFFFAOYSA-N |
| SMILES | COc1cc(F)c(-n2c(=O)[nH]c3csc(C(=O)O)c3c2=O)cc1OCc1c(OC)ccc(F)c1F |
| Linzagolix |
| 3-{5-[(2,3-Difluoro-6-methoxybenzyl)oxy]-2-fluoro-4-methoxyphenyl}-2,4-dioxo-1,2,3,4-tetrahydrothieno[3,4-d]pyrimidine-5-carboxylic acid |
| Thieno[3,4-d]pyrimidine-5-carboxylic acid, 3-[5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-2-fluoro-4-methoxyphenyl]-1,2,3,4-tetrahydro-2,4-dioxo- |