Carbanilic acid, p-chloro-, m-tolyl ester (7CI) structure
|
Common Name | Carbanilic acid, p-chloro-, m-tolyl ester (7CI) | ||
|---|---|---|---|---|
| CAS Number | 93535-11-6 | Molecular Weight | 261.70400 | |
| Density | 1.291g/cm3 | Boiling Point | 363.7ºC at 760mmHg | |
| Molecular Formula | C14H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.8ºC | |
| Name | (3-methylphenyl) N-(4-chlorophenyl)carbamate |
|---|
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 363.7ºC at 760mmHg |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.70400 |
| Flash Point | 173.8ºC |
| Exact Mass | 261.05600 |
| PSA | 38.33000 |
| LogP | 4.33230 |
| Index of Refraction | 1.627 |
| InChIKey | KWTFQJJQOLXVJM-UHFFFAOYSA-N |
| SMILES | Cc1cccc(OC(=O)Nc2ccc(Cl)cc2)c1 |
| HS Code | 2924299090 |
|---|
|
~%
Carbanilic acid... CAS#:93535-11-6 |
| Literature: Kao; Fang; Sah Sci.Rep.Tsing Hua Univ., 1936 , vol. 3, p. 109,110,111 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |