Benzene,1-chloro-2-[(4-chlorophenyl)methoxymethyl]- structure
|
Common Name | Benzene,1-chloro-2-[(4-chlorophenyl)methoxymethyl]- | ||
|---|---|---|---|---|
| CAS Number | 93535-56-9 | Molecular Weight | 267.15000 | |
| Density | 1.234g/cm3 | Boiling Point | 332.1ºC at 760 mmHg | |
| Molecular Formula | C14H12Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 74ºC | |
| Name | 1-chloro-2-[(4-chlorophenyl)-methoxy-methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 332.1ºC at 760 mmHg |
| Molecular Formula | C14H12Cl2O |
| Molecular Weight | 267.15000 |
| Flash Point | 74ºC |
| Exact Mass | 266.02700 |
| PSA | 9.23000 |
| LogP | 4.72920 |
| Index of Refraction | 1.577 |
| InChIKey | OPPDUVOWKCUPTO-UHFFFAOYSA-N |
| SMILES | COC(c1ccc(Cl)cc1)c1ccccc1Cl |
|
~%
Benzene,1-chlor... CAS#:93535-56-9 |
| Literature: Zee-Cheng,K.Y.; Cheng,C.C. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 1008 - 1015 |
|
~%
Benzene,1-chlor... CAS#:93535-56-9 |
| Literature: Zee-Cheng,K.Y.; Cheng,C.C. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 1008 - 1015 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methoxy-(2-chlor-phenyl)-(4-chlor-phenyl)-methan |