2-[2-(2-amino-4,6-dichloro-phenoxy)phenyl]acetic acid structure
|
Common Name | 2-[2-(2-amino-4,6-dichloro-phenoxy)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 93565-99-2 | Molecular Weight | 312.14800 | |
| Density | 1.461g/cm3 | Boiling Point | 446.8ºC at 760mmHg | |
| Molecular Formula | C14H11Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224ºC | |
| Name | 2-[2-(2-amino-4,6-dichlorophenoxy)phenyl]acetic acid |
|---|
| Density | 1.461g/cm3 |
|---|---|
| Boiling Point | 446.8ºC at 760mmHg |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.14800 |
| Flash Point | 224ºC |
| Exact Mass | 311.01200 |
| PSA | 72.55000 |
| LogP | 4.57620 |
| Index of Refraction | 1.649 |
| InChIKey | AWGKPGVOYKMLIJ-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)cc(Cl)c1Oc1ccccc1CC(=O)O |
|
~%
2-[2-(2-amino-4... CAS#:93565-99-2 |
| Literature: Stillings; Freeman; Myers; Readhead; Welbourn; Rance; Atkinson Journal of Medicinal Chemistry, 1985 , vol. 28, # 2 p. 225 - 233 |