Formamide,N-[4-amino-2,6-bis(methylthio)-5-pyrimidinyl]-N-(phenylmethyl)- structure
|
Common Name | Formamide,N-[4-amino-2,6-bis(methylthio)-5-pyrimidinyl]-N-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 93569-41-6 | Molecular Weight | 320.43300 | |
| Density | 1.36g/cm3 | Boiling Point | 552.4ºC at 760 mmHg | |
| Molecular Formula | C14H16N4OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.9ºC | |
| Name | N-[4-amino-2,6-bis(methylsulfanyl)pyrimidin-5-yl]-N-benzylformamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 552.4ºC at 760 mmHg |
| Molecular Formula | C14H16N4OS2 |
| Molecular Weight | 320.43300 |
| Flash Point | 287.9ºC |
| Exact Mass | 320.07700 |
| PSA | 122.71000 |
| LogP | 3.88270 |
| Index of Refraction | 1.684 |
| InChIKey | PEDGFXUVZZLFSH-UHFFFAOYSA-N |
| SMILES | CSc1nc(N)c(N(C=O)Cc2ccccc2)c(SC)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(4-amino-2,6-bis-methylsulfanyl-pyrimidin-5-yl)-N-benzyl-formamide |
| N-<4-Amino-2,6-bis-methylthio-5-pyrimidinyl>-N-benzyl-formamid |