4-amino-5-chlorobenzofuran-7-carboxylic acid structure
|
Common Name | 4-amino-5-chlorobenzofuran-7-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 935696-96-1 | Molecular Weight | 211.602 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 408.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.6±28.7 °C | |
| Name | 7-Benzofurancarboxylic acid, 4-amino-5-chloro |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.1±45.0 °C at 760 mmHg |
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.602 |
| Flash Point | 200.6±28.7 °C |
| Exact Mass | 211.003616 |
| PSA | 76.46000 |
| LogP | 2.67 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | ZXVBXMMWTGCOCZ-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(C(=O)O)c2occc12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Amino-5-chlorobenzofuran-7-carboxylic acid |
| 4-Amino-5-chloro-1-benzofuran-7-carboxylic acid |
| 7-Benzofurancarboxylic acid, 4-amino-5-chloro- |