2-[(4-methoxyphenoxy)methyl]-3,3-dimethyl-but-1-ene structure
|
Common Name | 2-[(4-methoxyphenoxy)methyl]-3,3-dimethyl-but-1-ene | ||
|---|---|---|---|---|
| CAS Number | 93570-41-3 | Molecular Weight | 220.30700 | |
| Density | 0.951g/cm3 | Boiling Point | 304.4ºC at 760 mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.7ºC | |
| Name | 1-(3,3-dimethyl-2-methylidenebutoxy)-4-methoxybenzene |
|---|
| Density | 0.951g/cm3 |
|---|---|
| Boiling Point | 304.4ºC at 760 mmHg |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.30700 |
| Flash Point | 108.7ºC |
| Exact Mass | 220.14600 |
| PSA | 18.46000 |
| LogP | 3.67630 |
| Index of Refraction | 1.49 |
| InChIKey | NPYCUBJPNIFWKM-UHFFFAOYSA-N |
| SMILES | C=C(COc1ccc(OC)cc1)C(C)(C)C |
|
~%
2-[(4-methoxyph... CAS#:93570-41-3 |
| Literature: White,W.N.; Norcross,B.E. Journal of the American Chemical Society, 1961 , vol. 83, p. 3265 - 3269 |
|
~%
2-[(4-methoxyph... CAS#:93570-41-3 |
| Literature: White,W.N.; Norcross,B.E. Journal of the American Chemical Society, 1961 , vol. 83, p. 3265 - 3269 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |