2-Nitro-5-fluoropyridine N-oxide
Modify Date: 2025-08-25 12:02:47
2-Nitro-5-fluoropyridine N-oxide structure
|
Common Name | 2-Nitro-5-fluoropyridine N-oxide | ||
|---|---|---|---|---|
| CAS Number | 935753-02-9 | Molecular Weight | 158.08700 | |
| Density | 1.56g/cm3 | Boiling Point | 403.9ºC at 760 mmHg | |
| Molecular Formula | C5H3FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.1ºC | |
| Name | 5-fluoro-2-nitro-1-oxidopyridin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 403.9ºC at 760 mmHg |
| Molecular Formula | C5H3FN2O3 |
| Molecular Weight | 158.08700 |
| Flash Point | 198.1ºC |
| Exact Mass | 158.01300 |
| PSA | 71.28000 |
| LogP | 1.68560 |
| Index of Refraction | 1.576 |
| InChIKey | VCULLFRHZQRKNL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(F)c[n+]1[O-] |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Nitro-5-fluoropyridine N-oxide |