3-(6-amino-1,3-benzodioxol-5-yl)prop-2-enoic acid structure
|
Common Name | 3-(6-amino-1,3-benzodioxol-5-yl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 93577-94-7 | Molecular Weight | 207.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(6-amino-1,3-benzodioxol-5-yl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9NO4 |
|---|---|
| Molecular Weight | 207.18300 |
| Exact Mass | 207.05300 |
| PSA | 81.78000 |
| LogP | 1.67650 |
| InChIKey | YOESHDPMOUQUSU-UHFFFAOYSA-N |
| SMILES | Nc1cc2c(cc1C=CC(=O)O)OCO2 |
|
~%
3-(6-amino-1,3-... CAS#:93577-94-7 |
| Literature: Perkin Journal of the Chemical Society, 1891 , vol. 59, p. 158 |
| 6-Amino-3,4-methylendioxy-zimtsaeure |