3,5-DIHYDRO-7-NITRO-4H-PYRROLO[3,2-D]PYRIMIDIN-4-ONE structure
|
Common Name | 3,5-DIHYDRO-7-NITRO-4H-PYRROLO[3,2-D]PYRIMIDIN-4-ONE | ||
|---|---|---|---|---|
| CAS Number | 93587-26-9 | Molecular Weight | 180.12100 | |
| Density | 2.026g/cm3 | Boiling Point | 606.66ºC at 760 mmHg | |
| Molecular Formula | C6H4N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.697ºC | |
| Name | 7-nitro-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.026g/cm3 |
|---|---|
| Boiling Point | 606.66ºC at 760 mmHg |
| Molecular Formula | C6H4N4O3 |
| Molecular Weight | 180.12100 |
| Flash Point | 320.697ºC |
| Exact Mass | 180.02800 |
| PSA | 107.36000 |
| LogP | 0.68260 |
| Index of Refraction | 1.882 |
| InChIKey | VJQHZPGWPTUHFJ-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N1)C(=O)NC=N2)[N+](=O)[O-] |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4(5H)-one |
| 3,5-Dihydro-7-nitro-4H-pyrrolo[3,2-d]pyrimidin-4-one |