LSP1-2111 structure
|
Common Name | LSP1-2111 | ||
|---|---|---|---|---|
| CAS Number | 936234-43-4 | Molecular Weight | 364.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17N2O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LSP1-2111LSP1-2111 is a potent, selective, and brain penetrant group III mGluRs agonist with EC50 of 2.2 and 1.7 uM for mGluR4 and mGluR6, respectively. |
| Name | (2S)-2-Amino-4-{hydroxy[hydroxy(4-hydroxy-3-methoxy-5-nitrophenyl )methyl]phosphoryl}butanoic acid |
|---|
| Molecular Formula | C12H17N2O9P |
|---|---|
| Molecular Weight | 364.24500 |
| Exact Mass | 364.06700 |
| PSA | 205.94000 |
| LogP | 1.59580 |
| InChIKey | PEXVMHLARUAHNC-UHFFFAOYSA-N |
| SMILES | COc1cc(C(O)P(=O)(O)CCC(N)C(=O)O)cc([N+](=O)[O-])c1O |