(2Z)-2-Acetamido-3-(4-methylphenyl)acrylic acid structure
|
Common Name | (2Z)-2-Acetamido-3-(4-methylphenyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 93634-59-4 | Molecular Weight | 219.236 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 463.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.3±28.7 °C | |
| Name | 2-acetamido-3-(4-methylphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.8±45.0 °C at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.236 |
| Flash Point | 234.3±28.7 °C |
| Exact Mass | 219.089539 |
| PSA | 69.89000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | XLKTTWGSTMQVIL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(=Cc1ccc(C)cc1)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~81%
(2Z)-2-Acetamid... CAS#:93634-59-4 |
| Literature: Chen; Lee; Huang; Tzeng Nucleosides and Nucleotides, 1993 , vol. 12, # 9 p. 925 - 940 |
|
~%
(2Z)-2-Acetamid... CAS#:93634-59-4 |
| Literature: Chen; Lee; Huang; Tzeng Nucleosides and Nucleotides, 1993 , vol. 12, # 9 p. 925 - 940 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Propenoic acid, 2-(acetylamino)-3-(4-methylphenyl)-, (2Z)- |
| (2Z)-2-Acetamido-3-(4-methylphenyl)acrylic acid |