1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide)
Modify Date: 2025-11-05 22:50:19
1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide) structure
|
Common Name | 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide) | ||
|---|---|---|---|---|
| CAS Number | 936475-00-2 | Molecular Weight | 720.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C48H50O2P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C48H50O2P2 |
|---|---|
| Molecular Weight | 720.9 |
| InChIKey | USFYXQCAXOZHHH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(P(=O)(c2cc(C)cc(C)c2)c2cc3ccc2CCc2ccc(c(P(=O)(c4cc(C)cc(C)c4)c4cc(C)cc(C)c4)c2)CC3)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide)? |
| A: Molecular formula of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide) is C48H50O2P2. |
| Q: What is the English name of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide)? |
| A: The English name of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide) is 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide). |
| Q: What is the InChIKey of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide)? |
| A: InChIKey of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide) is USFYXQCAXOZHHH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide)? |
| A: Molecular weight of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide) is 720.9. |
| Q: What is the SMILES notation of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide)? |
| A: SMILES notation of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide) is Cc1cc(C)cc(P(=O)(c2cc(C)cc(C)c2)c2cc3ccc2CCc2ccc(c(P(=O)(c4cc(C)cc(C)c4)c4cc(C)cc(C)c4)c2)CC3)c1. |
| Q: What is the Chinese name of 936475-00-2? |
| A: Chinese name of 936475-00-2 is 936475-00-2. |
| Q: What is the CAS number of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide)? |
| A: CAS number of 1,4(1,4)-Dibenzenacyclohexaphane-12,43-diylbis(bis(3,5-dimethylphenyl)phosphine oxide) is 936475-00-2. |