Forsythoside E
Modify Date: 2026-07-03 15:48:04
Forsythoside E structure
|
Common Name | Forsythoside E | ||
|---|---|---|---|---|
| CAS Number | 93675-88-8 | Molecular Weight | 462.445 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 752.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 408.6±32.9 °C | |
Use of Forsythoside EForsythoside E is a phenylethanoid glycoside isolated from the fruits of forsythia suspense (thunb.) vahl[1]. |
| Name | forsythoside E |
|---|---|
| Synonym | More Synonyms |
| Description | Forsythoside E is a phenylethanoid glycoside isolated from the fruits of forsythia suspense (thunb.) vahl[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 752.0±60.0 °C at 760 mmHg |
| Molecular Formula | C20H30O12 |
| Molecular Weight | 462.445 |
| Flash Point | 408.6±32.9 °C |
| Exact Mass | 462.173737 |
| PSA | 198.76000 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | QIMGUQIHCNDUKU-OJJLXHDHSA-N |
| SMILES | CC1OC(OCC2OC(OCCc3ccc(O)c(O)c3)C(O)C(O)C2O)C(O)C(O)C1O |
| 2-(3,4-Dihydroxyphenyl)ethyl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-L-glucopyranoside |
| DecaffeoylforsythosideA |