3-(2,4-dichlorophenyl)-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione
Modify Date: 2025-08-25 19:19:32
3-(2,4-dichlorophenyl)-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione structure
|
Common Name | 3-(2,4-dichlorophenyl)-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 93677-85-1 | Molecular Weight | 336.23900 | |
| Density | 1.42g/cm3 | Boiling Point | 431.3ºC at 760mmHg | |
| Molecular Formula | C15H11Cl2N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.6ºC | |
| Name | 3-(2,4-dichlorophenyl)-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 431.3ºC at 760mmHg |
| Molecular Formula | C15H11Cl2N3S |
| Molecular Weight | 336.23900 |
| Flash Point | 214.6ºC |
| Exact Mass | 335.00500 |
| PSA | 69.51000 |
| LogP | 4.83820 |
| Index of Refraction | 1.695 |
| InChIKey | KQIRTXDTOXJSCL-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-n1c(-c2ccc(Cl)cc2Cl)n[nH]c1=S |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(2,4-dichlorophenyl)-4-(2-methylphenyl)-4H-1,2,4-triazole-3-thiol |