tert-Butyl (2-cyano-1H-pyrrol-1-yl)carbamate structure
|
Common Name | tert-Butyl (2-cyano-1H-pyrrol-1-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 937046-96-3 | Molecular Weight | 207.229 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-Butyl (2-cyano-1H-pyrrol-1-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.229 |
| Exact Mass | 207.100784 |
| PSA | 67.05000 |
| LogP | 1.68 |
| Index of Refraction | 1.535 |
| InChIKey | SXUSNFHKHIJDRN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nn1cccc1C#N |
| HS Code | 2933990090 |
|---|
|
~75%
tert-Butyl (2-c... CAS#:937046-96-3 |
| Literature: BAYER PHARMACEUTICALS CORPORATION Patent: WO2007/64931 A2, 2007 ; Location in patent: Page/Page column 161-162 ; |
|
~%
tert-Butyl (2-c... CAS#:937046-96-3 |
| Literature: BIOCRYST PHARMACEUTICALS, INC.; BABU, Yarlagadda, S.; KOTIAN, Pravin, L.; WU, Minwan Patent: WO2011/150356 A1, 2011 ; WO 2011/150356 A1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl N-(2-cyanopyrrol-1-yl)carbamate |
| 2-Methyl-2-propanyl (2-cyano-1H-pyrrol-1-yl)carbamate |
| T5NJ AMVOX1&1&1 BCN |
| Carbamic acid, N-(2-cyano-1H-pyrrol-1-yl)-, 1,1-dimethylethyl ester |
| 1,1-Dimethylethyl N-(2-cyano-1H-pyrrol-1-yl)carbamate |