Benzenemethanol,3-[(dimethylamino)methyl]-2-methyl-a-phenyl- structure
|
Common Name | Benzenemethanol,3-[(dimethylamino)methyl]-2-methyl-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 93723-12-7 | Molecular Weight | 255.35500 | |
| Density | 1.064g/cm3 | Boiling Point | 378.6ºC at 760mmHg | |
| Molecular Formula | C17H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.1ºC | |
| Name | [3-[(dimethylamino)methyl]-2-methylphenyl]-phenylmethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 378.6ºC at 760mmHg |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.35500 |
| Flash Point | 142.1ºC |
| Exact Mass | 255.16200 |
| PSA | 23.47000 |
| LogP | 3.13830 |
| Index of Refraction | 1.579 |
| InChIKey | CMRARKZUTRFMBU-UHFFFAOYSA-N |
| SMILES | Cc1c(CN(C)C)cccc1C(O)c1ccccc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-3-dimethylaminomethyl-benzhydrol |