4,4-dicyclopropylbut-3-enyl benzoate structure
|
Common Name | 4,4-dicyclopropylbut-3-enyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 93727-40-3 | Molecular Weight | 256.33900 | |
| Density | 1.155g/cm3 | Boiling Point | 370ºC at 760 mmHg | |
| Molecular Formula | C17H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.5ºC | |
| Name | 4,4-dicyclopropylbut-3-enyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 370ºC at 760 mmHg |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.33900 |
| Flash Point | 168.5ºC |
| Exact Mass | 256.14600 |
| PSA | 26.30000 |
| LogP | 3.97990 |
| Index of Refraction | 1.594 |
| InChIKey | GYHZQTDNAAWFMD-UHFFFAOYSA-N |
| SMILES | O=C(OCCC=C(C1CC1)C1CC1)c1ccccc1 |
|
~%
4,4-dicycloprop... CAS#:93727-40-3 |
| Literature: Hart,H.; Law,P.A. Journal of the American Chemical Society, 1962 , vol. 84, p. 2462 - 2463 |
| 4,4-Dicyclopropyl-buten-(3)-yl-benzoat |
| 1,1-Dicyclopropyl-allylcabinylbenzoat |
| 4,4-dicyclopropylbut-3-en-1-yl benzoate |