Benzoic acid, 3-(2,2,3,3-tetrafluoropropoxy)
Modify Date: 2025-08-26 10:28:08
Benzoic acid, 3-(2,2,3,3-tetrafluoropropoxy) structure
|
Common Name | Benzoic acid, 3-(2,2,3,3-tetrafluoropropoxy) | ||
|---|---|---|---|---|
| CAS Number | 937602-64-7 | Molecular Weight | 252.16200 | |
| Density | 1.391±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 321.8±42.0 °C (760 mmHg) | |
| Molecular Formula | C10H8F4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzoic acid, 3-(2,2,3,3-tetrafluoropropoxy) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.391±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 321.8±42.0 °C (760 mmHg) |
| Molecular Formula | C10H8F4O3 |
| Molecular Weight | 252.16200 |
| Exact Mass | 252.04100 |
| PSA | 46.53000 |
| LogP | 2.66400 |
| InChIKey | DJHPUSYYAQOIPI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(OCC(F)(F)C(F)F)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(2,2,3,3-tetrafluoropropoxy)benzoic acid |