3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)propanoic acid
Modify Date: 2025-09-03 17:16:34
3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)propanoic acid structure
|
Common Name | 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 937669-19-7 | Molecular Weight | 196.20300 | |
| Density | 1.301g/cm3 | Boiling Point | 471.296ºC at 760 mmHg | |
| Molecular Formula | C9H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.832ºC | |
| Name | 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 471.296ºC at 760 mmHg |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.20300 |
| Flash Point | 238.832ºC |
| Exact Mass | 196.08500 |
| PSA | 83.31000 |
| LogP | 0.81620 |
| Index of Refraction | 1.573 |
| InChIKey | ONPLCUHLIAMYCI-UHFFFAOYSA-N |
| SMILES | Cc1nc(=O)[nH]c(C)c1CCC(=O)O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| f3379-0336 |