methyl 5-bromo-2-(2-methylpropylamino)benzoate
Modify Date: 2025-08-28 18:41:12
methyl 5-bromo-2-(2-methylpropylamino)benzoate structure
|
Common Name | methyl 5-bromo-2-(2-methylpropylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 937678-69-8 | Molecular Weight | 286.16500 | |
| Density | 1.344g/cm3 | Boiling Point | 338.369ºC at 760 mmHg | |
| Molecular Formula | C12H16BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.44ºC | |
| Name | methyl 5-bromo-2-(2-methylpropylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 338.369ºC at 760 mmHg |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.16500 |
| Flash Point | 158.44ºC |
| Exact Mass | 285.03600 |
| PSA | 38.33000 |
| LogP | 3.37660 |
| Index of Refraction | 1.563 |
| InChIKey | UDVQKXNCRGDQBT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)ccc1NCC(C)C |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| methyl 5-bromo-2-(isobutylamino)benzoate |