2-[5-[5-(4-methoxyphenyl)furan-2-yl]tetrazol-2-yl]acetic acid
Modify Date: 2025-09-10 08:48:23
![2-[5-[5-(4-methoxyphenyl)furan-2-yl]tetrazol-2-yl]acetic acid Structure](https://image.chemsrc.com/caspic/361/93770-37-7.png)
2-[5-[5-(4-methoxyphenyl)furan-2-yl]tetrazol-2-yl]acetic acid structure
|
Common Name | 2-[5-[5-(4-methoxyphenyl)furan-2-yl]tetrazol-2-yl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 93770-37-7 | Molecular Weight | 300.26900 | |
| Density | 1.47g/cm3 | Boiling Point | 573ºC at 760mmHg | |
| Molecular Formula | C14H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.3ºC | |
| Name | 2-[5-[5-(4-methoxyphenyl)furan-2-yl]tetrazol-2-yl]acetic acid |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 573ºC at 760mmHg |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.26900 |
| Flash Point | 300.3ºC |
| Exact Mass | 300.08600 |
| PSA | 103.27000 |
| LogP | 1.69330 |
| InChIKey | WHBSNQWWRPRTKZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc(-c3nnn(CC(=O)O)n3)o2)cc1 |
|
~90%
2-[5-[5-(4-meth... CAS#:93770-37-7 |
| Literature: Janda; Voticky; Jakubcova; et al. Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 7 p. 1699 - 1712 |
|
~%
2-[5-[5-(4-meth... CAS#:93770-37-7 |
| Literature: Janda; Voticky; Jakubcova; et al. Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 7 p. 1699 - 1712 |
![5-[5-(4-methoxyphenyl)furan-2-yl]-2H-tetrazole structure](https://image.chemsrc.com/caspic/434/60838-11-1.png)