2-[5-[5-(3-methylphenyl)furan-2-yl]tetrazol-1-yl]acetic acid structure
|
Common Name | 2-[5-[5-(3-methylphenyl)furan-2-yl]tetrazol-1-yl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 93770-56-0 | Molecular Weight | 284.27000 | |
| Density | 1.43g/cm3 | Boiling Point | 543.2ºC at 760mmHg | |
| Molecular Formula | C14H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.3ºC | |
| Name | 2-[5-[5-(3-methylphenyl)furan-2-yl]tetrazol-1-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 543.2ºC at 760mmHg |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.27000 |
| Flash Point | 282.3ºC |
| Exact Mass | 284.09100 |
| PSA | 94.04000 |
| LogP | 1.99310 |
| InChIKey | KBMPCIIFQMNVED-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2ccc(-c3nnnn3CC(=O)O)o2)c1 |
|
~92%
2-[5-[5-(3-meth... CAS#:93770-56-0 |
| Literature: Janda; Voticky; Jakubcova; et al. Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 7 p. 1699 - 1712 |
|
~%
2-[5-[5-(3-meth... CAS#:93770-56-0 |
| Literature: Janda; Voticky; Jakubcova; et al. Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 7 p. 1699 - 1712 |
| 5-(5-(3-Methylphenyl)-2-furanyl)-1H-tetrazole-1-acetic acid |
| 5-(5-(3-METHYLPHENYL)-FURAN-2-YL)-1H-TETRAZOLE-1-ACETIC ACID |
| 1H-Tetrazole-1-acetic acid,5-(5-(3-methylphenyl)-2-furanyl) |