2-[5-[5-(2-nitrophenyl)furan-2-yl]tetrazol-1-yl]acetic acid structure
|
Common Name | 2-[5-[5-(2-nitrophenyl)furan-2-yl]tetrazol-1-yl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 93770-59-3 | Molecular Weight | 315.24100 | |
| Density | 1.67g/cm3 | Boiling Point | 605.1ºC at 760mmHg | |
| Molecular Formula | C13H9N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.8ºC | |
| Name | 2-[5-[5-(2-nitrophenyl)furan-2-yl]tetrazol-1-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 605.1ºC at 760mmHg |
| Molecular Formula | C13H9N5O5 |
| Molecular Weight | 315.24100 |
| Flash Point | 319.8ºC |
| Exact Mass | 315.06000 |
| PSA | 139.86000 |
| LogP | 2.11610 |
| InChIKey | UBIAIJKPTBZAIX-UHFFFAOYSA-N |
| SMILES | O=C(O)Cn1nnnc1-c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
|
~89%
2-[5-[5-(2-nitr... CAS#:93770-59-3 |
| Literature: Janda; Voticky; Jakubcova; et al. Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 7 p. 1699 - 1712 |
|
~%
2-[5-[5-(2-nitr... CAS#:93770-59-3 |
| Literature: Janda; Voticky; Jakubcova; et al. Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 7 p. 1699 - 1712 |
| 5-(5-(2-Nitrophenyl)-2-furanyl)-1H-tetrazole-1-acetic acid |
| 5-(5-(2-NITROPHENYL)-FURAN-2-YL)-1H-TETRAZOLE-1-ACETIC ACID |
| 1H-Tetrazole-1-acetic acid,5-(5-(2-nitrophenyl)-2-furanyl) |