naphthalene-1,5-disulphonic acid, compound with 1-[4-(4-chlorophenyl)-3-phenylbut-2-enyl]pyrrolidine (1:2) structure
|
Common Name | naphthalene-1,5-disulphonic acid, compound with 1-[4-(4-chlorophenyl)-3-phenylbut-2-enyl]pyrrolidine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 93777-57-2 | Molecular Weight | 911.99400 | |
| Density | N/A | Boiling Point | 1014.8ºC at 760 mmHg | |
| Molecular Formula | C50H52Cl2N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 567.5ºC | |
| Name | 1-[(Z)-4-(4-chlorophenyl)-3-phenylbut-2-enyl]pyrrolidine,naphthalene-1,5-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 1014.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C50H52Cl2N2O6S2 |
| Molecular Weight | 911.99400 |
| Flash Point | 567.5ºC |
| Exact Mass | 910.26400 |
| PSA | 131.98000 |
| LogP | 13.49440 |
| InChIKey | OCOQSLMGOIWOJJ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(CC(=CCN2CCCC2)c2ccccc2)cc1.Clc1ccc(CC(=CCN2CCCC2)c2ccccc2)cc1.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12 |
| einecs 298-089-6 |