3-Prenyl-2,4,6-trihydroxybenzophenone structure
|
Common Name | 3-Prenyl-2,4,6-trihydroxybenzophenone | ||
|---|---|---|---|---|
| CAS Number | 93796-20-4 | Molecular Weight | 298.333 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 461.0±24.0 °C at 760 mmHg | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.7±19.4 °C | |
| Name | Phenyl[2,4,6-trihydroxy-3-(3-methyl-2-buten-1-yl)phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 461.0±24.0 °C at 760 mmHg |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.333 |
| Flash Point | 246.7±19.4 °C |
| Exact Mass | 298.120514 |
| PSA | 77.76000 |
| LogP | 5.59 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | WKFZVPVRFGJMEY-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(O)cc(O)c(C(=O)c2ccccc2)c1O |
| HS Code | 2914400090 |
|---|
|
~1%
3-Prenyl-2,4,6-... CAS#:93796-20-4
Detail
|
| Literature: Cann, Martin R.; Davis, Anne-Marie; Shannon, Patrick V. R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 7 p. 1413 - 1421 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Methanone, phenyl[2,4,6-trihydroxy-3-(3-methyl-2-buten-1-yl)phenyl]- |
| 3-p-octyloxyphenyl 6-chloropyridazine |
| 3-prenyl-2,4,6-trihydroxybenzophenone |
| Phenyl[2,4,6-trihydroxy-3-(3-methyl-2-buten-1-yl)phenyl]methanone |