dibromo-fluoro-sulfanylidene-λ5-phosphane structure
|
Common Name | dibromo-fluoro-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 93799-37-2 | Molecular Weight | 241.84500 | |
| Density | 1.167g/cm3 | Boiling Point | 557.6ºC at 760 mmHg | |
| Molecular Formula | Br2FPS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1ºC | |
| Name | dibromo-fluoro-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 557.6ºC at 760 mmHg |
| Molecular Formula | Br2FPS |
| Molecular Weight | 241.84500 |
| Flash Point | 291.1ºC |
| Exact Mass | 239.78100 |
| PSA | 41.90000 |
| LogP | 3.62080 |
| Index of Refraction | 1.555 |
| InChIKey | QBEQMOQXAHTSRR-UHFFFAOYSA-N |
| SMILES | CC1(C)C=C(C(=O)NCCCN2C(=O)c3ccccc3C2=O)C(C)(C)N1 |
|
~%
dibromo-fluoro-... CAS#:93799-37-2 |
| Literature: Hankovszky; Hideg; Bodi; Frank Journal of Medicinal Chemistry, 1986 , vol. 29, # 7 p. 1138 - 1152 |
|
~%
dibromo-fluoro-... CAS#:93799-37-2 |
| Literature: Hankovszky; Hideg; Bodi; Frank Journal of Medicinal Chemistry, 1986 , vol. 29, # 7 p. 1138 - 1152 |
|
~%
dibromo-fluoro-... CAS#:93799-37-2 |
| Literature: Sar; Kalai; Baracz; Jerkovich; Hideg Synthetic Communications, 1995 , vol. 25, # 19 p. 2929 - 2940 |
| Thiophosphoryl dibromide fluoride |
| Thiophosphoryl dibromide monofluoride |
| Thiophosphoryl fluorodibromide |
| Dibromofluorophosphine sulfide |
| TL 331 |