5-oxo-L-proline, compound with 3',4'-dihydroxy-2-(methylamino)acetophenone (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with 3',4'-dihydroxy-2-(methylamino)acetophenone (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93804-82-1 | Molecular Weight | 310.30300 | |
| Density | N/A | Boiling Point | 700ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 377.1ºC | |
| Name | 1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanone,(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 700ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.30300 |
| Flash Point | 377.1ºC |
| Exact Mass | 310.11600 |
| PSA | 139.45000 |
| LogP | 0.51630 |
| InChIKey | FFQNWEOMFMQVFL-HVDRVSQOSA-N |
| SMILES | CNCC(=O)c1ccc(O)c(O)c1.O=C1CCC(C(=O)O)N1 |
| einecs 298-460-2 |