5-oxo-L-proline, compound with α-(1-aminoethyl)benzyl alcohol (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with α-(1-aminoethyl)benzyl alcohol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93804-93-4 | Molecular Weight | 280.32000 | |
| Density | N/A | Boiling Point | 596.6ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.6ºC | |
| Name | 2-amino-1-phenylpropan-1-ol,(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 596.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32000 |
| Flash Point | 314.6ºC |
| Exact Mass | 280.14200 |
| PSA | 116.14000 |
| LogP | 1.39300 |
| InChIKey | AABUXZMOFROJNY-HVDRVSQOSA-N |
| SMILES | CC(N)C(O)c1ccccc1.O=C1CCC(C(=O)O)N1 |
| einecs 298-472-8 |