ethyl 3-(p-isopropylphenyl)oxirane-2-carboxylate structure
|
Common Name | ethyl 3-(p-isopropylphenyl)oxirane-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 93805-69-7 | Molecular Weight | 234.29100 | |
| Density | 1.101g/cm3 | Boiling Point | 312.6ºC at 760mmHg | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.9ºC | |
| Name | ethyl 3-(4-propan-2-ylphenyl)oxirane-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 312.6ºC at 760mmHg |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29100 |
| Flash Point | 127.9ºC |
| Exact Mass | 234.12600 |
| PSA | 38.83000 |
| LogP | 2.81300 |
| Index of Refraction | 1.523 |
| InChIKey | ITNKSNPSUNGFLE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1OC1c1ccc(C(C)C)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
ethyl 3-(p-isop... CAS#:93805-69-7 |
| Literature: Ohloff Archiv der Pharmazie (Weinheim, Germany), 1954 , vol. 287, p. 272,278 |
|
~50%
ethyl 3-(p-isop... CAS#:93805-69-7 |
| Literature: Murray, Robert W.; Shiang, Dawn L. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1990 , # 2 p. 349 - 352 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 298-552-2 |
| 2,3-epoxy-3-(4-isopropyl-phenyl)-propionic acid ethyl ester |
| trans-ethyl 3-(4-isopropylphenyl)oxirane-2-carboxylate |
| 2,3-Epoxy-3-(4-isopropyl-phenyl)-propionsaeure-aethylester |
| Ethyl 3-(p-isopropylphenyl)oxirane-2-carboxylate |