N-[4-(aminocarbonyl)phenyl]-4-methoxy-3-nitrobenzamide structure
|
Common Name | N-[4-(aminocarbonyl)phenyl]-4-methoxy-3-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 93839-20-4 | Molecular Weight | 315.28100 | |
| Density | 1.414g/cm3 | Boiling Point | 486.3ºC at 760mmHg | |
| Molecular Formula | C15H13N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.9ºC | |
| Name | N-(4-Carbamoylphenyl)-4-methoxy-3-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 486.3ºC at 760mmHg |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.28100 |
| Flash Point | 247.9ºC |
| Exact Mass | 315.08600 |
| PSA | 127.24000 |
| LogP | 3.25110 |
| Index of Refraction | 1.667 |
| InChIKey | JXHSJUAPWJKPLE-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(N)=O)cc2)cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-[4-(aminocarbonyl)phenyl]-4-methoxy-3-nitrobenzamide |
| Acetamide,N-[4-[(acetyloxy)methyl]-2-cyano-5-methylphenyl] |
| N-[4-(acetyloxymethyl)-2-cyano-5-methylphenyl]-acetamide |