benzyltriphenylphosphonium, salt with 4-octylphenol (1:1) structure
|
Common Name | benzyltriphenylphosphonium, salt with 4-octylphenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93839-60-2 | Molecular Weight | 558.73200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H43OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl(triphenyl)phosphanium,4-octylphenolate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C39H43OP |
|---|---|
| Molecular Weight | 558.73200 |
| Exact Mass | 558.30500 |
| PSA | 36.65000 |
| LogP | 9.91410 |
| InChIKey | XBFQQHNOIBDWIQ-UHFFFAOYSA-M |
| SMILES | CCCCCCCCc1ccc([O-])cc1.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| Benzyltriphenylphosphonium,salt with 4-octylphenol (1:1) |
| EINECS 298-830-3 |