ethyltriphenylphosphonium, salt with 4-chloro-3,5-xylenol (1:1) structure
|
Common Name | ethyltriphenylphosphonium, salt with 4-chloro-3,5-xylenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93840-99-4 | Molecular Weight | 446.94800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H28ClOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-3,5-dimethylphenolate,ethyl(triphenyl)phosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H28ClOP |
|---|---|
| Molecular Weight | 446.94800 |
| Exact Mass | 446.15700 |
| PSA | 36.65000 |
| LogP | 7.10100 |
| InChIKey | SXROBFNIJFOYQT-UHFFFAOYSA-M |
| SMILES | CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cc1cc([O-])cc(C)c1Cl |
| Ethyltriphenylphosphonium,salt with 4-chloro-3,5-xylenol (1:1) |
| EINECS 298-967-9 |