benzyltriphenylphosphonium, salt with 4-benzylphenol (1:1) structure
|
Common Name | benzyltriphenylphosphonium, salt with 4-benzylphenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93841-07-7 | Molecular Weight | 536.64200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H33OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-benzylphenolate,benzyl(triphenyl)phosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C38H33OP |
|---|---|
| Molecular Weight | 536.64200 |
| Exact Mass | 536.22700 |
| PSA | 36.65000 |
| LogP | 8.60190 |
| InChIKey | JLUYFROQWJGRAD-UHFFFAOYSA-M |
| SMILES | [O-]c1ccc(Cc2ccccc2)cc1.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| Benzyltriphenylphosphonium,salt with 4-benzylphenol (1:1) |
| EINECS 298-976-8 |