5-benzyl-5-phenylbarbituric acid structure
|
Common Name | 5-benzyl-5-phenylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 93841-22-6 | Molecular Weight | 294.30500 | |
| Density | 1.285g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-benzyl-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285g/cm3 |
|---|---|
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.30500 |
| Exact Mass | 294.10000 |
| PSA | 82.25000 |
| LogP | 2.08490 |
| Index of Refraction | 1.606 |
| InChIKey | RIYDTHLUCWFCEN-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(Cc2ccccc2)(c2ccccc2)C(=O)N1 |
| HS Code | 2933540000 |
|---|
|
~%
5-benzyl-5-phen... CAS#:93841-22-6 |
| Literature: Bayer and Co. Patent: DE247952 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 927 |
|
~%
5-benzyl-5-phen... CAS#:93841-22-6 |
| Literature: Bayer and Co. Patent: DE247952 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 927 |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5-benzyl-5-phenyl-barbituric acid |
| 5-Benzyl-5-phenyl-barbitursaeure |
| EINECS 298-993-0 |