2-[(tributylstannyl)oxy]-N-[2-[(tributylstannyl)oxy]ethyl]ethylamine structure
|
Common Name | 2-[(tributylstannyl)oxy]-N-[2-[(tributylstannyl)oxy]ethyl]ethylamine | ||
|---|---|---|---|---|
| CAS Number | 93841-41-9 | Molecular Weight | 683.20700 | |
| Density | N/A | Boiling Point | 562.5ºC at 760mmHg | |
| Molecular Formula | C28H63NO2Sn2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294ºC | |
| Name | 2-tributylstannyloxy-N-(2-tributylstannyloxyethyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 562.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C28H63NO2Sn2 |
| Molecular Weight | 683.20700 |
| Flash Point | 294ºC |
| Exact Mass | 685.29000 |
| PSA | 58.15000 |
| LogP | 8.78990 |
| InChIKey | YPJRVYXUOGFXST-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)OCCNCCO[Sn](CCCC)(CCCC)CCCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 299-010-8 |
| 2-((Tributylstannyl)oxy)-N-(2-((tributylstannyl)oxy)ethyl)ethylamine |
| Ethanamine,2-[(tributylstannyl)oxy]-N-[2-[(tributylstannyl)oxy]ethyl] |