4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with N,N-diethyl-N'-(6-methoxyquinolin-8-yl)propane-1,3-diamine (1:1) structure
|
Common Name | 4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with N,N-diethyl-N'-(6-methoxyquinolin-8-yl)propane-1,3-diamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93841-81-7 | Molecular Weight | 675.76900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H41N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid,N',N'-diethyl-N-(6-methoxyquinolin-8-yl)propane-1,3-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C40H41N3O7 |
|---|---|
| Molecular Weight | 675.76900 |
| Exact Mass | 675.29400 |
| PSA | 152.45000 |
| LogP | 7.85160 |
| InChIKey | LBECWLRDWPBGCU-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCNc1cc(OC)cc2cccnc12.O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
| 4,4'-Methylenebis(3-hydroxy-2-naphthoic) acid,compound with N,N-diethyl-N'-(6-methoxyquinolin-8-yl)propane-1,3-diamine (1:1) |
| EINECS 299-053-2 |