(4-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone
Modify Date: 2025-11-03 10:07:44
![(4-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone Structure](https://image.chemsrc.com/caspic/385/938458-70-9.png)
(4-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone structure
|
Common Name | (4-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 938458-70-9 | Molecular Weight | 276.71500 | |
| Density | 1.222g/cm3 | Boiling Point | 414.2ºC at 760 mmHg | |
| Molecular Formula | C15H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.1ºC | |
| Name | (4-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone |
|---|
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 414.2ºC at 760 mmHg |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.71500 |
| Flash Point | 167.1ºC |
| Exact Mass | 276.05500 |
| PSA | 35.53000 |
| LogP | 3.55370 |
| Index of Refraction | 1.567 |
| InChIKey | TUOYUPPWCASZBI-UHFFFAOYSA-N |
| SMILES | COCOc1cccc(C(=O)c2ccc(Cl)cc2)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |