1-(3-chloro-4-methylphenyl)piperidin-4-one
Modify Date: 2025-08-26 11:37:30
1-(3-chloro-4-methylphenyl)piperidin-4-one structure
|
Common Name | 1-(3-chloro-4-methylphenyl)piperidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 938459-09-7 | Molecular Weight | 223.69900 | |
| Density | 1.199g/cm3 | Boiling Point | 387.2ºC at 760 mmHg | |
| Molecular Formula | C12H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188ºC | |
| Name | 1-(3-chloro-4-methylphenyl)piperidin-4-one |
|---|
| Density | 1.199g/cm3 |
|---|---|
| Boiling Point | 387.2ºC at 760 mmHg |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.69900 |
| Flash Point | 188ºC |
| Exact Mass | 223.07600 |
| PSA | 20.31000 |
| LogP | 2.88270 |
| Index of Refraction | 1.567 |
| InChIKey | AQYBAIHPUWXOAS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2CCC(=O)CC2)cc1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |