5-oxo-L-proline, compound with 5,7-dibromoquinolin-8-ol (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with 5,7-dibromoquinolin-8-ol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93857-29-5 | Molecular Weight | 432.06400 | |
| Density | N/A | Boiling Point | 663.1ºC at 760 mmHg | |
| Molecular Formula | C14H12Br2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.8ºC | |
| Name | 5,7-dibromoquinolin-8-ol,(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 663.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H12Br2N2O4 |
| Molecular Weight | 432.06400 |
| Flash Point | 354.8ºC |
| Exact Mass | 429.91600 |
| PSA | 103.01000 |
| LogP | 3.09090 |
| InChIKey | DRZJRTZZIKMYSU-HVDRVSQOSA-N |
| SMILES | O=C1CCC(C(=O)O)N1.Oc1c(Br)cc(Br)c2cccnc12 |
| einecs 299-162-5 |