sodium 3-deoxy-D-arabino-hexonate structure
|
Common Name | sodium 3-deoxy-D-arabino-hexonate | ||
|---|---|---|---|---|
| CAS Number | 93857-40-0 | Molecular Weight | 202.13800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11NaO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,(2S,4S,5R)-2,4,5,6-tetrahydroxyhexanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H11NaO6 |
|---|---|
| Molecular Weight | 202.13800 |
| Exact Mass | 202.04500 |
| PSA | 121.05000 |
| InChIKey | ZRBXQRZQHABLKN-ASMLCRKRSA-M |
| SMILES | O=C([O-])C(O)CC(O)C(O)CO.[Na+] |
| HS Code | 2918199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 299-174-0 |
| Sodium 3-deoxy-D-arabino-hexonate |