N,N'-(9,10-dihydro-2-nitro-9,10-dioxo-1,4-anthracenediyl)bisacetamide structure
|
Common Name | N,N'-(9,10-dihydro-2-nitro-9,10-dioxo-1,4-anthracenediyl)bisacetamide | ||
|---|---|---|---|---|
| CAS Number | 93858-05-0 | Molecular Weight | 367.31200 | |
| Density | 1.549g/cm3 | Boiling Point | 731.5ºC at 760mmHg | |
| Molecular Formula | C18H13N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 396.2ºC | |
| Name | N-(4-acetamido-3-nitro-9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.549g/cm3 |
|---|---|
| Boiling Point | 731.5ºC at 760mmHg |
| Molecular Formula | C18H13N3O6 |
| Molecular Weight | 367.31200 |
| Flash Point | 396.2ºC |
| Exact Mass | 367.08000 |
| PSA | 145.14000 |
| LogP | 4.10920 |
| Index of Refraction | 1.721 |
| InChIKey | PRXIYLQUHGYOSN-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])c(NC(C)=O)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2924299090 |
|---|
|
~%
N,N'-(9,10-dihy... CAS#:93858-05-0 |
| Literature: Hoechster Farbw. Patent: DE254185 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 561 |
|
~%
N,N'-(9,10-dihy... CAS#:93858-05-0 |
| Literature: Hoechster Farbw. Patent: DE254185 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 561 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-(9,10-Dihydro-2-nitro-9,10-dioxo-1,4-anthracenediyl)bisacetamide |
| 2-Nitro-1.4-bis-acetamino-anthrachinon |
| EINECS 299-240-9 |
| 1,4-bis-acetylamino-2-nitro-anthraquinone |
| 1,4-Bis-acetylamino-2-nitro-anthrachinon |