1-[3-(1-hydroxyethyl)-2,4,5,6-tetramethyl-phenyl]ethanol structure
|
Common Name | 1-[3-(1-hydroxyethyl)-2,4,5,6-tetramethyl-phenyl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 93864-99-4 | Molecular Weight | 222.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[3-(1-hydroxyethyl)-2,4,5,6-tetramethylphenyl]ethanol |
|---|
| Molecular Formula | C14H22O2 |
|---|---|
| Molecular Weight | 222.32300 |
| Exact Mass | 222.16200 |
| PSA | 40.46000 |
| LogP | 3.02680 |
| InChIKey | MNLUEYUMTPEYGC-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C(C)O)c(C)c(C(C)O)c1C |
|
~%
1-[3-(1-hydroxy... CAS#:93864-99-4 |
| Literature: Newman,M.S. et al. Journal of the American Chemical Society, 1964 , vol. 86, p. 868 - 872 |
|
~%
1-[3-(1-hydroxy... CAS#:93864-99-4 |
| Literature: Newman,M.S. et al. Journal of the American Chemical Society, 1964 , vol. 86, p. 868 - 872 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |