methyl (5Z)-5-[(2,4-dinitrophenyl)hydrazinylidene]-5-phenyl-pentanoate structure
|
Common Name | methyl (5Z)-5-[(2,4-dinitrophenyl)hydrazinylidene]-5-phenyl-pentanoate | ||
|---|---|---|---|---|
| CAS Number | 93881-04-0 | Molecular Weight | 386.35900 | |
| Density | 1.34g/cm3 | Boiling Point | 539.734ºC at 760 mmHg | |
| Molecular Formula | C18H18N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.221ºC | |
| Name | methyl (5E)-5-[(2,4-dinitrophenyl)hydrazinylidene]-5-phenylpentanoate |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 539.734ºC at 760 mmHg |
| Molecular Formula | C18H18N4O6 |
| Molecular Weight | 386.35900 |
| Flash Point | 280.221ºC |
| Exact Mass | 386.12300 |
| PSA | 142.33000 |
| LogP | 4.78190 |
| Index of Refraction | 1.61 |
| InChIKey | FDXIRTJHZNRIMP-CYVLTUHYSA-N |
| SMILES | COC(=O)CCCC(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
|
~%
methyl (5Z)-5-[... CAS#:93881-04-0 |
| Literature: Allen; Cressman Journal of the American Chemical Society, 1933 , vol. 55, p. 2953,2958 |
|
~%
methyl (5Z)-5-[... CAS#:93881-04-0 |
| Literature: Allen; Cressman Journal of the American Chemical Society, 1933 , vol. 55, p. 2953,2958 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |