naphthalene-1-sulphonic acid, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | naphthalene-1-sulphonic acid, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93892-11-6 | Molecular Weight | 313.36900 | |
| Density | N/A | Boiling Point | 608.8ºC at 760 mmHg | |
| Molecular Formula | C14H19NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322ºC | |
| Name | 2-(2-hydroxyethylamino)ethanol,naphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 608.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.36900 |
| Flash Point | 322ºC |
| Exact Mass | 313.09800 |
| PSA | 115.24000 |
| LogP | 2.11880 |
| InChIKey | NMMKJVBEODGHOK-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cccc2ccccc12.OCCNCCO |
| einecs 299-491-4 |