2-methylnaphthalene-1-sulphonic acid, compound with 2-aminoethanol (1:1) structure
|
Common Name | 2-methylnaphthalene-1-sulphonic acid, compound with 2-aminoethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93892-72-9 | Molecular Weight | 283.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-aminoethanol,2-methylnaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17NO4S |
|---|---|
| Molecular Weight | 283.34300 |
| Exact Mass | 283.08800 |
| PSA | 109.00000 |
| LogP | 3.11340 |
| InChIKey | LFMBRBIVBYLOLV-UHFFFAOYSA-N |
| SMILES | Cc1ccc2ccccc2c1S(=O)(=O)O.NCCO |
| EINECS 299-558-8 |
| 2-Methylnaphthalene-1-sulphonic acid,compound with 2-aminoethanol(1:1) |