2-methylnaphthalene-1-sulphonic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1) structure
|
Common Name | 2-methylnaphthalene-1-sulphonic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93892-74-1 | Molecular Weight | 371.44900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,2-methylnaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H25NO6S |
|---|---|
| Molecular Weight | 371.44900 |
| Exact Mass | 371.14000 |
| PSA | 126.68000 |
| LogP | 1.74100 |
| InChIKey | LDOKXOHOFMXIIS-UHFFFAOYSA-N |
| SMILES | Cc1ccc2ccccc2c1S(=O)(=O)O.OCCN(CCO)CCO |
| EINECS 299-560-9 |
| 2-Methylnaphthalene-1-sulphonic acid,compound with 2,2',2''-nitrilotris(ethanol) (1:1) |