4,?-dimethylbenzenesulphonic acid, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | 4,?-dimethylbenzenesulphonic acid, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93893-09-5 | Molecular Weight | 291.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dimethylbenzenesulfonic acid,2-(2-hydroxyethylamino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H21NO5S |
|---|---|
| Molecular Weight | 291.36400 |
| Exact Mass | 291.11400 |
| PSA | 115.24000 |
| LogP | 1.58240 |
| InChIKey | QSIBTXTWTSKVEG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)c(C)c1.OCCNCCO |
| EINECS 299-597-0 |
| 4,-Dimethylbenzenesulphonic acid,compound with 2,2'-iminodiethanol (1:1) |