4,?-dimethylbenzenesulphonic acid, compound with 2-aminoethanol (1:1) structure
|
Common Name | 4,?-dimethylbenzenesulphonic acid, compound with 2-aminoethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93893-10-8 | Molecular Weight | 247.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-aminoethanol,2,4-dimethylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H17NO4S |
|---|---|
| Molecular Weight | 247.31100 |
| Exact Mass | 247.08800 |
| PSA | 109.00000 |
| LogP | 2.26860 |
| InChIKey | MSBZODOHHFKVJI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)c(C)c1.NCCO |
| EINECS 299-598-6 |
| 4,-Dimethylbenzenesulphonic acid,compound with 2-aminoethanol (1:1) |