4,?-dimethylbenzenesulphonic acid, compound with triethylamine (1:1) structure
|
Common Name | 4,?-dimethylbenzenesulphonic acid, compound with triethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93893-11-9 | Molecular Weight | 287.41800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-diethylethanamine,2,4-dimethylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H25NO3S |
|---|---|
| Molecular Weight | 287.41800 |
| Exact Mass | 287.15600 |
| PSA | 65.99000 |
| LogP | 3.97900 |
| InChIKey | RXGGIFKSYWBZEH-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.Cc1ccc(S(=O)(=O)O)c(C)c1 |
| EINECS 299-599-1 |
| 4,-Dimethylbenzenesulphonic acid,compound with triethylamine (1:1) |